C30H23N3O5 — CID 68940132
7-(4-carboxy-2-methylphenyl)-3-[3-(2-cyanoquinolin-8-yl)oxypropyl]-1H-indole-2-carboxylic acid (PubChem CID 68940132) has the molecular formula C30H23N3O5 and a molecular weight of 505.53 g/mol. Its IUPAC name is 7-(4-carboxy-2-methylphenyl)-3-[3-(2-cyanoquinolin-8-yl)oxypropyl]-1H-indole-2-carboxylic acid.
| Compound Name | 7-(4-carboxy-2-methylphenyl)-3-[3-(2-cyanoquinolin-8-yl)oxypropyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68940132 |
| Molecular Formula | C30H23N3O5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 7-(4-carboxy-2-methylphenyl)-3-[3-(2-cyanoquinolin-8-yl)oxypropyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cccc2c(CCCOc3cccc4ccc(C#N)nc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C30H23N3O5/c1-17-15-19(29(34)35)11-13-21(17)22-6-3-7-23-24(28(30(36)37)33-27(22)23)8-4-14-38-25-9-2-5-18-10-12-20(16-31)32-26(18)25/h2-3,5-7,9-13,15,33H,4,8,14H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | MKASWCULYJUGON-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|