C30H27NO6 — CID 68943547
7-(4-carboxy-2-methylphenyl)-3-[3-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]propyl]-1H-indole-2-carboxylic acid (PubChem CID 68943547) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is 7-(4-carboxy-2-methylphenyl)-3-[3-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]propyl]-1H-indole-2-carboxylic acid.
| Compound Name | 7-(4-carboxy-2-methylphenyl)-3-[3-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]propyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68943547 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 7-(4-carboxy-2-methylphenyl)-3-[3-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]propyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cccc2c(CCCOc3cccc4c3CCCC4=O)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C30H27NO6/c1-17-16-18(29(33)34)13-14-19(17)22-8-2-9-23-24(28(30(35)36)31-27(22)23)10-5-15-37-26-12-4-6-20-21(26)7-3-11-25(20)32/h2,4,6,8-9,12-14,16,31H,3,5,7,10-11,15H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | VLPXWSDFLQWGME-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|