C40H36N2O6S — CID 130273733
[7-[1-(benzenesulfonyl)-2,2,4-trimethylquinolin-3-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130273733) has the molecular formula C40H36N2O6S and a molecular weight of 672.80 g/mol. Its IUPAC name is [7-[1-(benzenesulfonyl)-2,2,4-trimethylquinolin-3-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-[1-(benzenesulfonyl)-2,2,4-trimethylquinolin-3-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130273733 |
| Molecular Formula | C40H36N2O6S |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | [7-[1-(benzenesulfonyl)-2,2,4-trimethylquinolin-3-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | CC1=C(c2cccc3c(CCCOc4cccc5ccccc45)c(OC(=O)O)[nH]c23)C(C)(C)N(S(=O)(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C40H36N2O6S/c1-26-29-18-9-10-23-34(29)42(49(45,46)28-16-5-4-6-17-28)40(2,3)36(26)33-21-12-20-31-32(38(41-37(31)33)48-39(43)44)22-13-25-47-35-24-11-15-27-14-7-8-19-30(27)35/h4-12,14-21,23-24,41H,13,22,25H2,1-3H3,(H,43,44) |
| InChIKey | ICJZDNOYNZMMOG-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|