C29H23F3N2O4 — CID 25144196
7-[5-amino-2-(trifluoromethoxy)phenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 25144196) has the molecular formula C29H23F3N2O4 and a molecular weight of 520.51 g/mol. Its IUPAC name is 7-[5-amino-2-(trifluoromethoxy)phenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-[5-amino-2-(trifluoromethoxy)phenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25144196 |
| Molecular Formula | C29H23F3N2O4 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 7-[5-amino-2-(trifluoromethoxy)phenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | Nc1ccc(OC(F)(F)F)c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)[nH]c23)c1 |
| InChI | InChI=1S/C29H23F3N2O4/c30-29(31,32)38-25-14-13-18(33)16-23(25)22-10-4-9-20-21(27(28(35)36)34-26(20)22)11-5-15-37-24-12-3-7-17-6-1-2-8-19(17)24/h1-4,6-10,12-14,16,34H,5,11,15,33H2,(H,35,36) |
| InChIKey | QNSSQWDDGCOSON-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|