C28H44N3O4Si+ — CID 153463126
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-2-methyl-1H-pyrazol-2-ium-4-yl]-6-methyl-1H-indole-2-carboxylate (PubChem CID 153463126) has the molecular formula C28H44N3O4Si+ and a molecular weight of 514.76 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-2-methyl-1H-pyrazol-2-ium-4-yl]-6-methyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-2-methyl-1H-pyrazol-2-ium-4-yl]-6-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 153463126 |
| Molecular Formula | C28H44N3O4Si+ |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-2-methyl-1H-pyrazol-2-ium-4-yl]-6-methyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CC)[nH][n+](C)c3CO)c(C)ccc2c1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H43N3O4Si/c1-10-21-24(22(17-32)31(7)30-21)23-18(3)14-15-20-19(26(29-25(20)23)27(33)34-11-2)13-12-16-35-36(8,9)28(4,5)6/h14-15,32H,10-13,16-17H2,1-9H3,(H,29,33)/p+1 |
| InChIKey | HFTGXQUGNXIWFX-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|