C18H28BrNOSi — CID 102042705
3-(6-bromo-2-methyl-1H-indol-3-yl)propoxy-tert-butyl-dimethylsilane (PubChem CID 102042705) has the molecular formula C18H28BrNOSi and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(6-bromo-2-methyl-1H-indol-3-yl)propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-(6-bromo-2-methyl-1H-indol-3-yl)propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102042705 |
| Molecular Formula | C18H28BrNOSi |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-(6-bromo-2-methyl-1H-indol-3-yl)propoxy-tert-butyl-dimethylsilane |
| SMILES | Cc1[nH]c2cc(Br)ccc2c1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28BrNOSi/c1-13-15(16-10-9-14(19)12-17(16)20-13)8-7-11-21-22(5,6)18(2,3)4/h9-10,12,20H,7-8,11H2,1-6H3 |
| InChIKey | NCGZQJRCAXGMKP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|