C17H25BrN2O2Si — CID 175953054
2-[4-bromo-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-1H-pyrazol-5-one (PubChem CID 175953054) has the molecular formula C17H25BrN2O2Si and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-[4-bromo-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-1H-pyrazol-5-one.
| Compound Name | 2-[4-bromo-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 175953054 |
| Molecular Formula | C17H25BrN2O2Si |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[4-bromo-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-1H-pyrazol-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cc(Br)ccc1-n1ccc(=O)[nH]1 |
| InChI | InChI=1S/C17H25BrN2O2Si/c1-17(2,3)23(4,5)22-11-9-13-12-14(18)6-7-15(13)20-10-8-16(21)19-20/h6-8,10,12H,9,11H2,1-5H3,(H,19,21) |
| InChIKey | NOCKCSCEPIUGDK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|