C27H40ClN3O4Si — CID 169015767
methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-1-methylindole-2-carboxylate (PubChem CID 169015767) has the molecular formula C27H40ClN3O4Si and a molecular weight of 534.17 g/mol. Its IUPAC name is methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-1-methylindole-2-carboxylate.
| Compound Name | methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 169015767 |
| Molecular Formula | C27H40ClN3O4Si |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-1-methylindole-2-carboxylate |
| SMILES | CCc1c(-c2c(Cl)ccc3c(CCCO[Si](C)(C)C(C)(C)C)c(C(=O)OC)n(C)c23)c(CO)nn1C |
| InChI | InChI=1S/C27H40ClN3O4Si/c1-10-21-23(20(16-32)29-31(21)6)22-19(28)14-13-18-17(25(26(33)34-7)30(5)24(18)22)12-11-15-35-36(8,9)27(2,3)4/h13-14,32H,10-12,15-16H2,1-9H3 |
| InChIKey | BRDQMCJRDUTHFM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|