C21H23Cl2N3O4 — CID 168800907
methyl 3-(3-acetyloxypropyl)-6-chloro-7-[3-(chloromethyl)-5-methyl-1H-pyrazol-4-yl]-1-methylindole-2-carboxylate (PubChem CID 168800907) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is methyl 3-(3-acetyloxypropyl)-6-chloro-7-[3-(chloromethyl)-5-methyl-1H-pyrazol-4-yl]-1-methylindole-2-carboxylate.
| Compound Name | methyl 3-(3-acetyloxypropyl)-6-chloro-7-[3-(chloromethyl)-5-methyl-1H-pyrazol-4-yl]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 168800907 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | methyl 3-(3-acetyloxypropyl)-6-chloro-7-[3-(chloromethyl)-5-methyl-1H-pyrazol-4-yl]-1-methylindole-2-carboxylate |
| SMILES | COC(=O)c1c(CCCOC(C)=O)c2ccc(Cl)c(-c3c(CCl)n[nH]c3C)c2n1C |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-11-17(16(10-22)25-24-11)18-15(23)8-7-14-13(6-5-9-30-12(2)27)20(21(28)29-4)26(3)19(14)18/h7-8H,5-6,9-10H2,1-4H3,(H,24,25) |
| InChIKey | BKFVLSBOEFBJOM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|