C28H40ClN3O4S2 — CID 164874614
methyl 1-(3-acetylsulfanylpropyl)-3-[3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxypropyl]-6-chloro-7-(1-methylpyrazol-4-yl)indole-2-carboxylate (PubChem CID 164874614) has the molecular formula C28H40ClN3O4S2 and a molecular weight of 582.23 g/mol. Its IUPAC name is methyl 1-(3-acetylsulfanylpropyl)-3-[3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxypropyl]-6-chloro-7-(1-methylpyrazol-4-yl)indole-2-carboxylate.
| Compound Name | methyl 1-(3-acetylsulfanylpropyl)-3-[3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxypropyl]-6-chloro-7-(1-methylpyrazol-4-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 164874614 |
| Molecular Formula | C28H40ClN3O4S2 |
| Molecular Weight | 582.23 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | methyl 1-(3-acetylsulfanylpropyl)-3-[3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxypropyl]-6-chloro-7-(1-methylpyrazol-4-yl)indole-2-carboxylate |
| SMILES | COC(=O)c1c(CCCOS(C)(C)C(C)(C)C)c2ccc(Cl)c(-c3cnn(C)c3)c2n1CCCSC(C)=O |
| InChI | InChI=1S/C28H40ClN3O4S2/c1-19(33)37-16-10-14-32-25-22(12-13-23(29)24(25)20-17-30-31(5)18-20)21(26(32)27(34)35-6)11-9-15-36-38(7,8)28(2,3)4/h12-13,17-18H,9-11,14-16H2,1-8H3 |
| InChIKey | QDIHOMHLQFBHMF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.23 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|