C23H25ClIN3O4 — CID 156503064
methyl 3-(3-acetyloxypropyl)-6-chloro-7-[2-(iodomethyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-1-methylindole-2-carboxylate (PubChem CID 156503064) has the molecular formula C23H25ClIN3O4 and a molecular weight of 569.83 g/mol. Its IUPAC name is methyl 3-(3-acetyloxypropyl)-6-chloro-7-[2-(iodomethyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-1-methylindole-2-carboxylate.
| Compound Name | methyl 3-(3-acetyloxypropyl)-6-chloro-7-[2-(iodomethyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 156503064 |
| Molecular Formula | C23H25ClIN3O4 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | methyl 3-(3-acetyloxypropyl)-6-chloro-7-[2-(iodomethyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-1-methylindole-2-carboxylate |
| SMILES | COC(=O)c1c(CCCOC(C)=O)c2ccc(Cl)c(-c3c(CI)nn4c3CCC4)c2n1C |
| InChI | InChI=1S/C23H25ClIN3O4/c1-13(29)32-11-5-6-14-15-8-9-16(24)19(21(15)27(2)22(14)23(30)31-3)20-17(12-25)26-28-10-4-7-18(20)28/h8-9H,4-7,10-12H2,1-3H3 |
| InChIKey | HKRDSXPTFGOHAY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|