C32H46ClN5O4S — CID 155691773
3-[7-[2-[[(Z)-2-amino-4-methyliminohex-2-enyl]sulfanylmethyl]-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-6-chloro-1-methyl-2-(methylperoxymethyl)indol-3-yl]propyl acetate;ethane (PubChem CID 155691773) has the molecular formula C32H46ClN5O4S and a molecular weight of 632.27 g/mol. Its IUPAC name is 3-[7-[2-[[(Z)-2-amino-4-methyliminohex-2-enyl]sulfanylmethyl]-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-6-chloro-1-methyl-2-(methylperoxymethyl)indol-3-yl]propyl acetate;ethane.
| Compound Name | 3-[7-[2-[[(Z)-2-amino-4-methyliminohex-2-enyl]sulfanylmethyl]-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-6-chloro-1-methyl-2-(methylperoxymethyl)indol-3-yl]propyl acetate;ethane |
|---|---|
| PubChem CID | 155691773 |
| Molecular Formula | C32H46ClN5O4S |
| Molecular Weight | 632.27 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 3-[7-[2-[[(Z)-2-amino-4-methyliminohex-2-enyl]sulfanylmethyl]-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-6-chloro-1-methyl-2-(methylperoxymethyl)indol-3-yl]propyl acetate;ethane |
| SMILES | CC.CCC(/C=C(\N)CSCc1nn2c(c1-c1c(Cl)ccc3c(CCCOC(C)=O)c(COOC)n(C)c13)CCC2)=N\C |
| InChI | InChI=1S/C30H40ClN5O4S.C2H6/c1-6-21(33-3)15-20(32)17-41-18-25-29(26-10-7-13-36(26)34-25)28-24(31)12-11-23-22(9-8-14-39-19(2)37)27(16-40-38-5)35(4)30(23)28;1-2/h11-12,15H,6-10,13-14,16-18,32H2,1-5H3;1-2H3/b20-15-,33-21+; |
| InChIKey | IFRTUMRIUPIUIA-DBPQFWHTSA-N |
| XLogP | 6.80 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.27 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|