About methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate
methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate (PubChem CID 158275466) has the molecular formula C20H17Cl2IN2O4
and a molecular weight of 547.18 g/mol. Its IUPAC name is methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate.
Molecular Properties
| Compound Name | methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate |
| PubChem CID | 158275466 |
| Molecular Formula | C20H17Cl2IN2O4 |
| Molecular Weight | 547.18 g/mol |
| Exact Mass | 545.96 |
| IUPAC Name | methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cnn(C)c2)cc1Cl.COC(=O)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O2.C8H6ClIO2/c1-15-7-9(6-14-15)8-3-4-10(11(13)5-8)12(16)17-2;1-12-8(11)6-3-2-5(10)4-7(6)9/h3-7H,1-2H3;2-4H,1H3 |
| InChIKey | GJNZXRCWEBQHSS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate?
The IUPAC name of methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate (CID 158275466) is methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate.
What is the SMILES notation for methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate?
The canonical SMILES for methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate is COC(=O)c1ccc(-c2cnn(C)c2)cc1Cl.COC(=O)c1ccc(I)cc1Cl.
What is the InChIKey of methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate?
The InChIKey is GJNZXRCWEBQHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2.C8H6ClIO2/c1-15-7-9(6-14-15)8-3-4-10(11(13)5-8)12(16)17-2;1-12-8(11)6-3-2-5(10)4-7(6)9/h3-7H,1-2H3;2-4H,1H3.
What are the key properties of methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate?
methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate has a molecular weight of 547.18 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-4-iodobenzoate;methyl 2-chloro-4-(1-methylpyrazol-4-yl)benzoate is sourced from PubChem (CID 158275466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).