C18H15BrClN3O2 — CID 142510619
methyl 2-(bromomethyl)-5-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]benzoate (PubChem CID 142510619) has the molecular formula C18H15BrClN3O2 and a molecular weight of 420.69 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-5-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]benzoate.
| Compound Name | methyl 2-(bromomethyl)-5-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]benzoate |
|---|---|
| PubChem CID | 142510619 |
| Molecular Formula | C18H15BrClN3O2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | methyl 2-(bromomethyl)-5-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]benzoate |
| SMILES | COC(=O)c1cc(-c2nc(Cl)ccc2-c2cnn(C)c2)ccc1CBr |
| InChI | InChI=1S/C18H15BrClN3O2/c1-23-10-13(9-21-23)14-5-6-16(20)22-17(14)11-3-4-12(8-19)15(7-11)18(24)25-2/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | JUGOYAGPBIZBPA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|