C17H13ClN4O — CID 142510634
6-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]-2,3-dihydroisoindol-1-one (PubChem CID 142510634) has the molecular formula C17H13ClN4O and a molecular weight of 324.77 g/mol. Its IUPAC name is 6-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 142510634 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-[6-chloro-3-(1-methylpyrazol-4-yl)-2-pyridinyl]-2,3-dihydroisoindol-1-one |
| SMILES | Cn1cc(-c2ccc(Cl)nc2-c2ccc3c(c2)C(=O)NC3)cn1 |
| InChI | InChI=1S/C17H13ClN4O/c1-22-9-12(8-20-22)13-4-5-15(18)21-16(13)10-2-3-11-7-19-17(23)14(11)6-10/h2-6,8-9H,7H2,1H3,(H,19,23) |
| InChIKey | IVWLJEYPADOFLZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|