C18H13ClF2N4O — CID 122648622
2-chloro-6-[[2,6-difluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 122648622) has the molecular formula C18H13ClF2N4O and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-chloro-6-[[2,6-difluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 2-chloro-6-[[2,6-difluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 122648622 |
| Molecular Formula | C18H13ClF2N4O |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-chloro-6-[[2,6-difluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | Cn1cc(-c2cc(F)c(CN3Cc4ccc(Cl)nc4C3=O)c(F)c2)cn1 |
| InChI | InChI=1S/C18H13ClF2N4O/c1-24-7-12(6-22-24)11-4-14(20)13(15(21)5-11)9-25-8-10-2-3-16(19)23-17(10)18(25)26/h2-7H,8-9H2,1H3 |
| InChIKey | CGORHDBPXBSIPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|