C35H48BrN5O7Si — CID 91094433
tert-butyl N-[[(4R)-4-[4-(1-methylpyrazol-4-yl)phenyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]methyl]carbamate;methyl 2-(bromomethyl)-5-methylbenzoate (PubChem CID 91094433) has the molecular formula C35H48BrN5O7Si and a molecular weight of 758.79 g/mol. Its IUPAC name is tert-butyl N-[[(4R)-4-[4-(1-methylpyrazol-4-yl)phenyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]methyl]carbamate;methyl 2-(bromomethyl)-5-methylbenzoate.
| Compound Name | tert-butyl N-[[(4R)-4-[4-(1-methylpyrazol-4-yl)phenyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]methyl]carbamate;methyl 2-(bromomethyl)-5-methylbenzoate |
|---|---|
| PubChem CID | 91094433 |
| Molecular Formula | C35H48BrN5O7Si |
| Molecular Weight | 758.79 g/mol |
| Exact Mass | 757.25 |
| IUPAC Name | tert-butyl N-[[(4R)-4-[4-(1-methylpyrazol-4-yl)phenyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]methyl]carbamate;methyl 2-(bromomethyl)-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1CBr.Cn1cc(-c2ccc([C@]3(CNC(=O)OC(C)(C)C)NC(=O)N(COCC[Si](C)(C)C)C3=O)cc2)cn1 |
| InChI | InChI=1S/C25H37N5O5Si.C10H11BrO2/c1-24(2,3)35-23(33)26-16-25(20-10-8-18(9-11-20)19-14-27-29(4)15-19)21(31)30(22(32)28-25)17-34-12-13-36(5,6)7;1-7-3-4-8(6-11)9(5-7)10(12)13-2/h8-11,14-15H,12-13,16-17H2,1-7H3,(H,26,33)(H,28,32);3-5H,6H2,1-2H3/t25-;/m0./s1 |
| InChIKey | IEHPHHFBOYBFOG-UQIIZPHYSA-N |
| XLogP | 6.35 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.79 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|