C20H32N8O5SSi — CID 153363619
tert-butyl N-[3-(1-methylpyrazol-4-yl)-2-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]pyrrol-1-yl]sulfonylcarbamate (PubChem CID 153363619) has the molecular formula C20H32N8O5SSi and a molecular weight of 524.68 g/mol. Its IUPAC name is tert-butyl N-[3-(1-methylpyrazol-4-yl)-2-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]pyrrol-1-yl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[3-(1-methylpyrazol-4-yl)-2-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]pyrrol-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 153363619 |
| Molecular Formula | C20H32N8O5SSi |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | tert-butyl N-[3-(1-methylpyrazol-4-yl)-2-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]pyrrol-1-yl]sulfonylcarbamate |
| SMILES | Cn1cc(-c2ccn(S(=O)(=O)NC(=O)OC(C)(C)C)c2-c2nnnn2COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C20H32N8O5SSi/c1-20(2,3)33-19(29)23-34(30,31)28-9-8-16(15-12-21-26(4)13-15)17(28)18-22-24-25-27(18)14-32-10-11-35(5,6)7/h8-9,12-13H,10-11,14H2,1-7H3,(H,23,29) |
| InChIKey | OXTCNMKKJBDXJP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|