C32H43F3N6O3Si — CID 164883715
tert-butyl N-[2-[4-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(2,2,2-trifluoroethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]propan-2-yl]carbamate (PubChem CID 164883715) has the molecular formula C32H43F3N6O3Si and a molecular weight of 644.82 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(2,2,2-trifluoroethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(2,2,2-trifluoroethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 164883715 |
| Molecular Formula | C32H43F3N6O3Si |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | tert-butyl N-[2-[4-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(2,2,2-trifluoroethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]propan-2-yl]carbamate |
| SMILES | Cc1cc(-c2c(CC(F)(F)F)c(-c3ccc(C(C)(C)NC(=O)OC(C)(C)C)cc3)nn2COCC[Si](C)(C)C)cn2ncnc12 |
| InChI | InChI=1S/C32H43F3N6O3Si/c1-21-16-23(18-40-28(21)36-19-37-40)27-25(17-32(33,34)35)26(39-41(27)20-43-14-15-45(7,8)9)22-10-12-24(13-11-22)31(5,6)38-29(42)44-30(2,3)4/h10-13,16,18-19H,14-15,17,20H2,1-9H3,(H,38,42) |
| InChIKey | CUIUJEIBYBCLQR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|