C22H28N4O4 — CID 166117401
tert-butyl N-[[4-[6-(3-hydroxypropoxy)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 166117401) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-(3-hydroxypropoxy)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-(3-hydroxypropoxy)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166117401 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | tert-butyl N-[[4-[6-(3-hydroxypropoxy)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2ncnn3cc(OCCCO)cc23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28N4O4/c1-15-10-16(6-7-17(15)12-23-21(28)30-22(2,3)4)20-19-11-18(29-9-5-8-27)13-26(19)25-14-24-20/h6-7,10-11,13-14,27H,5,8-9,12H2,1-4H3,(H,23,28) |
| InChIKey | FHZAFKPUXSUTGJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|