C26H26N4O3 — CID 166116899
tert-butyl N-[[4-[2-(4-formylphenyl)pyrazolo[4,3-b]pyridin-7-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 166116899) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-(4-formylphenyl)pyrazolo[4,3-b]pyridin-7-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-(4-formylphenyl)pyrazolo[4,3-b]pyridin-7-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166116899 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | tert-butyl N-[[4-[2-(4-formylphenyl)pyrazolo[4,3-b]pyridin-7-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2ccnc3cn(-c4ccc(C=O)cc4)nc23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H26N4O3/c1-17-13-19(7-8-20(17)14-28-25(32)33-26(2,3)4)22-11-12-27-23-15-30(29-24(22)23)21-9-5-18(16-31)6-10-21/h5-13,15-16H,14H2,1-4H3,(H,28,32) |
| InChIKey | YOJZNHADWBNJMA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|