C14H17N3O3 — CID 155167684
tert-butyl N-[(6-formylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate (PubChem CID 155167684) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is tert-butyl N-[(6-formylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-formylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 155167684 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl N-[(6-formylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn2cc(C=O)ccc2n1 |
| InChI | InChI=1S/C14H17N3O3/c1-14(2,3)20-13(19)15-6-11-8-17-7-10(9-18)4-5-12(17)16-11/h4-5,7-9H,6H2,1-3H3,(H,15,19) |
| InChIKey | UBVKVQUUWBRQKK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|