C19H21N3O2 — CID 175306900
tert-butyl N-[(7-phenylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate (PubChem CID 175306900) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is tert-butyl N-[(7-phenylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(7-phenylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 175306900 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[(7-phenylimidazo[1,2-a]pyridin-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn2ccc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C19H21N3O2/c1-19(2,3)24-18(23)20-12-16-13-22-10-9-15(11-17(22)21-16)14-7-5-4-6-8-14/h4-11,13H,12H2,1-3H3,(H,20,23) |
| InChIKey | DZJUXEROQPZUMJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |