C14H20N2O2 — CID 86618645
tert-butyl N-[(6-prop-2-enyl-2-pyridinyl)methyl]carbamate (PubChem CID 86618645) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is tert-butyl N-[(6-prop-2-enyl-2-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-prop-2-enyl-2-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 86618645 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl N-[(6-prop-2-enyl-2-pyridinyl)methyl]carbamate |
| SMILES | C=CCc1cccc(CNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C14H20N2O2/c1-5-7-11-8-6-9-12(16-11)10-15-13(17)18-14(2,3)4/h5-6,8-9H,1,7,10H2,2-4H3,(H,15,17) |
| InChIKey | SUYIAMFHFRIGDW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|