C10H14ClN3O2 — CID 77231610
tert-butyl N-[(6-chloropyrazin-2-yl)methyl]carbamate (PubChem CID 77231610) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is tert-butyl N-[(6-chloropyrazin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-chloropyrazin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 77231610 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | tert-butyl N-[(6-chloropyrazin-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cncc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3O2/c1-10(2,3)16-9(15)13-5-7-4-12-6-8(11)14-7/h4,6H,5H2,1-3H3,(H,13,15) |
| InChIKey | UOLVHJGYSHBODW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |