C10H13Cl2N3O2 — CID 170897744
tert-butyl N-[(2,6-dichloropyrimidin-4-yl)methyl]carbamate (PubChem CID 170897744) has the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is tert-butyl N-[(2,6-dichloropyrimidin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2,6-dichloropyrimidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 170897744 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | tert-butyl N-[(2,6-dichloropyrimidin-4-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-10(2,3)17-9(16)13-5-6-4-7(11)15-8(12)14-6/h4H,5H2,1-3H3,(H,13,16) |
| InChIKey | MQLCTOZIRPLPBV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |