C13H15ClN4O2 — CID 156818946
tert-butyl N-[(6-chloropyrido[3,2-c]pyridazin-3-yl)methyl]carbamate (PubChem CID 156818946) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is tert-butyl N-[(6-chloropyrido[3,2-c]pyridazin-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-chloropyrido[3,2-c]pyridazin-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 156818946 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | tert-butyl N-[(6-chloropyrido[3,2-c]pyridazin-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2nc(Cl)ccc2nn1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-13(2,3)20-12(19)15-7-8-6-10-9(18-17-8)4-5-11(14)16-10/h4-6H,7H2,1-3H3,(H,15,19) |
| InChIKey | XZXKRQTUKBHIOO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|