C15H18ClN3O2 — CID 123920794
tert-butyl N-[(2-amino-6-chloroquinolin-3-yl)methyl]carbamate (PubChem CID 123920794) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is tert-butyl N-[(2-amino-6-chloroquinolin-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-amino-6-chloroquinolin-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 123920794 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | tert-butyl N-[(2-amino-6-chloroquinolin-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2cc(Cl)ccc2nc1N |
| InChI | InChI=1S/C15H18ClN3O2/c1-15(2,3)21-14(20)18-8-10-6-9-7-11(16)4-5-12(9)19-13(10)17/h4-7H,8H2,1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | DFNUUNHWFAVUTF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |