C11H17N3O2S — CID 83669608
tert-butyl N-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)methyl]carbamate (PubChem CID 83669608) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is tert-butyl N-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 83669608 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | tert-butyl N-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OC(C)(C)C)nc(=S)[nH]1 |
| InChI | InChI=1S/C11H17N3O2S/c1-7-5-8(14-9(17)13-7)6-12-10(15)16-11(2,3)4/h5H,6H2,1-4H3,(H,12,15)(H,13,14,17) |
| InChIKey | PNUDJHJUSOCHTQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|