C14H23N3O3 — CID 67951653
tert-butyl N-[[5-(aminomethyl)-6-methoxy-4-methyl-2-pyridinyl]methyl]carbamate (PubChem CID 67951653) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is tert-butyl N-[[5-(aminomethyl)-6-methoxy-4-methyl-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(aminomethyl)-6-methoxy-4-methyl-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 67951653 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | tert-butyl N-[[5-(aminomethyl)-6-methoxy-4-methyl-2-pyridinyl]methyl]carbamate |
| SMILES | COc1nc(CNC(=O)OC(C)(C)C)cc(C)c1CN |
| InChI | InChI=1S/C14H23N3O3/c1-9-6-10(17-12(19-5)11(9)7-15)8-16-13(18)20-14(2,3)4/h6H,7-8,15H2,1-5H3,(H,16,18) |
| InChIKey | ZMUBHCWKXQCPOA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |