C12H16Cl3N3O3 — CID 176915180
tert-butyl N-[3-(2,4,6-trichloropyrimidin-5-yl)oxypropyl]carbamate (PubChem CID 176915180) has the molecular formula C12H16Cl3N3O3 and a molecular weight of 356.64 g/mol. Its IUPAC name is tert-butyl N-[3-(2,4,6-trichloropyrimidin-5-yl)oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,4,6-trichloropyrimidin-5-yl)oxypropyl]carbamate |
|---|---|
| PubChem CID | 176915180 |
| Molecular Formula | C12H16Cl3N3O3 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | tert-butyl N-[3-(2,4,6-trichloropyrimidin-5-yl)oxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1c(Cl)nc(Cl)nc1Cl |
| InChI | InChI=1S/C12H16Cl3N3O3/c1-12(2,3)21-11(19)16-5-4-6-20-7-8(13)17-10(15)18-9(7)14/h4-6H2,1-3H3,(H,16,19) |
| InChIKey | XFQBGWFPJXOEGQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|