C12H15ClF2N2O3 — CID 137346829
tert-butyl N-[[5-chloro-4-(difluoromethoxy)-2-pyridinyl]methyl]carbamate (PubChem CID 137346829) has the molecular formula C12H15ClF2N2O3 and a molecular weight of 308.71 g/mol. Its IUPAC name is tert-butyl N-[[5-chloro-4-(difluoromethoxy)-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-chloro-4-(difluoromethoxy)-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 137346829 |
| Molecular Formula | C12H15ClF2N2O3 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | tert-butyl N-[[5-chloro-4-(difluoromethoxy)-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(OC(F)F)c(Cl)cn1 |
| InChI | InChI=1S/C12H15ClF2N2O3/c1-12(2,3)20-11(18)17-5-7-4-9(19-10(14)15)8(13)6-16-7/h4,6,10H,5H2,1-3H3,(H,17,18) |
| InChIKey | FXUTUIAQPIEXGT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |