C13H18F2N2O4 — CID 154491102
tert-butyl N-[[3-(difluoromethoxy)-5-methyl-1-oxidopyridin-1-ium-2-yl]methyl]carbamate (PubChem CID 154491102) has the molecular formula C13H18F2N2O4 and a molecular weight of 304.29 g/mol. Its IUPAC name is tert-butyl N-[[3-(difluoromethoxy)-5-methyl-1-oxidopyridin-1-ium-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(difluoromethoxy)-5-methyl-1-oxidopyridin-1-ium-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 154491102 |
| Molecular Formula | C13H18F2N2O4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | tert-butyl N-[[3-(difluoromethoxy)-5-methyl-1-oxidopyridin-1-ium-2-yl]methyl]carbamate |
| SMILES | Cc1cc(OC(F)F)c(CNC(=O)OC(C)(C)C)[n+]([O-])c1 |
| InChI | InChI=1S/C13H18F2N2O4/c1-8-5-10(20-11(14)15)9(17(19)7-8)6-16-12(18)21-13(2,3)4/h5,7,11H,6H2,1-4H3,(H,16,18) |
| InChIKey | PHLNYWSEKSIPDS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|