C12H16N4O2 — CID 177333870
tert-butyl N-(pyrazolo[1,5-a]pyrazin-2-ylmethyl)carbamate (PubChem CID 177333870) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is tert-butyl N-(pyrazolo[1,5-a]pyrazin-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(pyrazolo[1,5-a]pyrazin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 177333870 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | tert-butyl N-(pyrazolo[1,5-a]pyrazin-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2cnccn2n1 |
| InChI | InChI=1S/C12H16N4O2/c1-12(2,3)18-11(17)14-7-9-6-10-8-13-4-5-16(10)15-9/h4-6,8H,7H2,1-3H3,(H,14,17) |
| InChIKey | DFGBGPHERAKFFA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |