C13H17N5O2 — CID 166103677
tert-butyl N-[[5-(triazol-2-yl)-2-pyridinyl]methyl]carbamate (PubChem CID 166103677) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is tert-butyl N-[[5-(triazol-2-yl)-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(triazol-2-yl)-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 166103677 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | tert-butyl N-[[5-(triazol-2-yl)-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-n2nccn2)cn1 |
| InChI | InChI=1S/C13H17N5O2/c1-13(2,3)20-12(19)15-8-10-4-5-11(9-14-10)18-16-6-7-17-18/h4-7,9H,8H2,1-3H3,(H,15,19) |
| InChIKey | RHRSXVDXJWOBHA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |