C15H19F3N2O2 — CID 169137281
tert-butyl N-[[5-[1-(trifluoromethyl)cyclopropyl]-2-pyridinyl]methyl]carbamate (PubChem CID 169137281) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is tert-butyl N-[[5-[1-(trifluoromethyl)cyclopropyl]-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[1-(trifluoromethyl)cyclopropyl]-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 169137281 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[[5-[1-(trifluoromethyl)cyclopropyl]-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C2(C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-13(2,3)22-12(21)20-9-11-5-4-10(8-19-11)14(6-7-14)15(16,17)18/h4-5,8H,6-7,9H2,1-3H3,(H,20,21) |
| InChIKey | RVLMSQPFAZCVQW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |