C16H20N4O3 — CID 170269703
tert-butyl N-[[5-(1-methyl-6-oxo-3-pyridinyl)pyrazin-2-yl]methyl]carbamate (PubChem CID 170269703) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl N-[[5-(1-methyl-6-oxo-3-pyridinyl)pyrazin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(1-methyl-6-oxo-3-pyridinyl)pyrazin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 170269703 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl N-[[5-(1-methyl-6-oxo-3-pyridinyl)pyrazin-2-yl]methyl]carbamate |
| SMILES | Cn1cc(-c2cnc(CNC(=O)OC(C)(C)C)cn2)ccc1=O |
| InChI | InChI=1S/C16H20N4O3/c1-16(2,3)23-15(22)19-8-12-7-18-13(9-17-12)11-5-6-14(21)20(4)10-11/h5-7,9-10H,8H2,1-4H3,(H,19,22) |
| InChIKey | PKSPUGSHZFOASL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |