C14H17ClN4O2 — CID 178054648
tert-butyl N-[[1-(4-chlorophenyl)triazol-4-yl]methyl]carbamate (PubChem CID 178054648) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-chlorophenyl)triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-chlorophenyl)triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 178054648 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | tert-butyl N-[[1-(4-chlorophenyl)triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn(-c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-14(2,3)21-13(20)16-8-11-9-19(18-17-11)12-6-4-10(15)5-7-12/h4-7,9H,8H2,1-3H3,(H,16,20) |
| InChIKey | RXFYYNGVCVAZAE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |