C15H19BrN4O2 — CID 163349907
tert-butyl N-[[1-[(2-bromophenyl)methyl]triazol-4-yl]methyl]carbamate (PubChem CID 163349907) has the molecular formula C15H19BrN4O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is tert-butyl N-[[1-[(2-bromophenyl)methyl]triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(2-bromophenyl)methyl]triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 163349907 |
| Molecular Formula | C15H19BrN4O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | tert-butyl N-[[1-[(2-bromophenyl)methyl]triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn(Cc2ccccc2Br)nn1 |
| InChI | InChI=1S/C15H19BrN4O2/c1-15(2,3)22-14(21)17-8-12-10-20(19-18-12)9-11-6-4-5-7-13(11)16/h4-7,10H,8-9H2,1-3H3,(H,17,21) |
| InChIKey | VZDKFQPFZIKVEG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |