C11H15N7O2 — CID 140770591
tert-butyl N-[[6-(tetrazol-2-yl)pyridazin-3-yl]methyl]carbamate (PubChem CID 140770591) has the molecular formula C11H15N7O2 and a molecular weight of 277.29 g/mol. Its IUPAC name is tert-butyl N-[[6-(tetrazol-2-yl)pyridazin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-(tetrazol-2-yl)pyridazin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 140770591 |
| Molecular Formula | C11H15N7O2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | tert-butyl N-[[6-(tetrazol-2-yl)pyridazin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-n2ncnn2)nn1 |
| InChI | InChI=1S/C11H15N7O2/c1-11(2,3)20-10(19)12-6-8-4-5-9(16-15-8)18-14-7-13-17-18/h4-5,7H,6H2,1-3H3,(H,12,19) |
| InChIKey | BCIAAGOMRWHGJK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |