C28H33N3O2 — CID 86618646
tert-butyl N-[[6-[(1-benzhydrylazetidin-3-yl)methyl]-2-pyridinyl]methyl]carbamate (PubChem CID 86618646) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl N-[[6-[(1-benzhydrylazetidin-3-yl)methyl]-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-[(1-benzhydrylazetidin-3-yl)methyl]-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 86618646 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | tert-butyl N-[[6-[(1-benzhydrylazetidin-3-yl)methyl]-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CC2CN(C(c3ccccc3)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C28H33N3O2/c1-28(2,3)33-27(32)29-18-25-16-10-15-24(30-25)17-21-19-31(20-21)26(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-16,21,26H,17-20H2,1-3H3,(H,29,32) |
| InChIKey | GPHKTBXLQXSEJT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |