C21H27ClN2O2 — CID 170994169
tert-butyl N-(1-benzhydrylazetidin-3-yl)carbamate;hydrochloride (PubChem CID 170994169) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is tert-butyl N-(1-benzhydrylazetidin-3-yl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(1-benzhydrylazetidin-3-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 170994169 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-(1-benzhydrylazetidin-3-yl)carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NC1CN(C(c2ccccc2)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-21(2,3)25-20(24)22-18-14-23(15-18)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17;/h4-13,18-19H,14-15H2,1-3H3,(H,22,24);1H |
| InChIKey | ZADGTIATFWLROC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |