C23H32N3O2+ — CID 123731050
(1-benzhydrylazetidin-3-yl)-dimethyl-[(2-methylpropan-2-yl)oxycarbonylamino]azanium (PubChem CID 123731050) has the molecular formula C23H32N3O2+ and a molecular weight of 382.53 g/mol. Its IUPAC name is (1-benzhydrylazetidin-3-yl)-dimethyl-[(2-methylpropan-2-yl)oxycarbonylamino]azanium.
| Compound Name | (1-benzhydrylazetidin-3-yl)-dimethyl-[(2-methylpropan-2-yl)oxycarbonylamino]azanium |
|---|---|
| PubChem CID | 123731050 |
| Molecular Formula | C23H32N3O2+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (1-benzhydrylazetidin-3-yl)-dimethyl-[(2-methylpropan-2-yl)oxycarbonylamino]azanium |
| SMILES | CC(C)(C)OC(=O)N[N+](C)(C)C1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H31N3O2/c1-23(2,3)28-22(27)24-26(4,5)20-16-25(17-20)21(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-21H,16-17H2,1-5H3/p+1 |
| InChIKey | DEAHKZXDYORWGQ-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|