C32H39N3O4S — CID 164557616
tert-butyl N-[1-[4-(1-benzhydrylazetidin-3-yl)oxyphenyl]sulfinylpiperidin-4-yl]carbamate (PubChem CID 164557616) has the molecular formula C32H39N3O4S and a molecular weight of 561.75 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(1-benzhydrylazetidin-3-yl)oxyphenyl]sulfinylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(1-benzhydrylazetidin-3-yl)oxyphenyl]sulfinylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 164557616 |
| Molecular Formula | C32H39N3O4S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | tert-butyl N-[1-[4-(1-benzhydrylazetidin-3-yl)oxyphenyl]sulfinylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)c2ccc(OC3CN(C(c4ccccc4)c4ccccc4)C3)cc2)CC1 |
| InChI | InChI=1S/C32H39N3O4S/c1-32(2,3)39-31(36)33-26-18-20-35(21-19-26)40(37)29-16-14-27(15-17-29)38-28-22-34(23-28)30(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,26,28,30H,18-23H2,1-3H3,(H,33,36) |
| InChIKey | MGGWYCYALNTJKD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |