C19H29N3O4S — CID 164556939
tert-butyl N-[1-[4-(azetidin-3-yloxy)phenyl]sulfinylpiperidin-4-yl]carbamate (PubChem CID 164556939) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(azetidin-3-yloxy)phenyl]sulfinylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(azetidin-3-yloxy)phenyl]sulfinylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 164556939 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | tert-butyl N-[1-[4-(azetidin-3-yloxy)phenyl]sulfinylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)c2ccc(OC3CNC3)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O4S/c1-19(2,3)26-18(23)21-14-8-10-22(11-9-14)27(24)17-6-4-15(5-7-17)25-16-12-20-13-16/h4-7,14,16,20H,8-13H2,1-3H3,(H,21,23) |
| InChIKey | QKYDOIPSMAPZEW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |