C10H20N2O4S — CID 19706124
4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-sulfinic acid (PubChem CID 19706124) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-sulfinic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 19706124 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-sulfinic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)O)CC1 |
| InChI | InChI=1S/C10H20N2O4S/c1-10(2,3)16-9(13)11-8-4-6-12(7-5-8)17(14)15/h8H,4-7H2,1-3H3,(H,11,13)(H,14,15) |
| InChIKey | NSDXKVZAMXWPLC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|