C14H19N5O2 — CID 155190382
tert-butyl N-[[2-(diazenylmethyl)imidazo[1,2-a]pyridin-6-yl]methyl]carbamate (PubChem CID 155190382) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is tert-butyl N-[[2-(diazenylmethyl)imidazo[1,2-a]pyridin-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(diazenylmethyl)imidazo[1,2-a]pyridin-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 155190382 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | tert-butyl N-[[2-(diazenylmethyl)imidazo[1,2-a]pyridin-6-yl]methyl]carbamate |
| SMILES | [H]/N=N/Cc1cn2cc(CNC(=O)OC(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C14H19N5O2/c1-14(2,3)21-13(20)16-6-10-4-5-12-18-11(7-17-15)9-19(12)8-10/h4-5,8-9,15H,6-7H2,1-3H3,(H,16,20)/b17-15+ |
| InChIKey | SFWRTVLHWPXQLP-BMRADRMJSA-N |
| XLogP | 2.89 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|