C13H18N4O2 — CID 150442768
tert-butyl N-[[4-(azidomethyl)phenyl]methyl]carbamate (PubChem CID 150442768) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl N-[[4-(azidomethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(azidomethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 150442768 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-[[4-(azidomethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C13H18N4O2/c1-13(2,3)19-12(18)15-8-10-4-6-11(7-5-10)9-16-17-14/h4-7H,8-9H2,1-3H3,(H,15,18) |
| InChIKey | HMCUEKPSQYHYTN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|