C10H15N5O2S — CID 167276246
tert-butyl N-[[5-(azidomethyl)-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 167276246) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is tert-butyl N-[[5-(azidomethyl)-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(azidomethyl)-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167276246 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | tert-butyl N-[[5-(azidomethyl)-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ncc(CN=[N+]=[N-])s1 |
| InChI | InChI=1S/C10H15N5O2S/c1-10(2,3)17-9(16)13-6-8-12-4-7(18-8)5-14-15-11/h4H,5-6H2,1-3H3,(H,13,16) |
| InChIKey | BCNQTNDGKQBFAG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|