C15H23N3O5S3 — CID 166424930
3-[2-[[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424930) has the molecular formula C15H23N3O5S3 and a molecular weight of 421.57 g/mol. Its IUPAC name is 3-[2-[[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166424930 |
| Molecular Formula | C15H23N3O5S3 |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-[2-[[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCc1ncc(C(=O)NCCSSCCC(=O)O)s1 |
| InChI | InChI=1S/C15H23N3O5S3/c1-15(2,3)23-14(22)18-9-11-17-8-10(26-11)13(21)16-5-7-25-24-6-4-12(19)20/h8H,4-7,9H2,1-3H3,(H,16,21)(H,18,22)(H,19,20) |
| InChIKey | PBIRPHBRVNQWNK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|